(Z)-icos-11-enoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

cis-11-eicosenoic acid; gondoic acid; (Z)-icos-11-enoic acid
CAS RN:[5561-99-9]
Formula:C20H38O2; 310.52 g/mol
InChiKey:BITHHVVYSMSWAG-KTKRTIGZSA-N
SMILES:CCCCCCCCC=C/CCCCCCCCCC(O)=O
Molecular structure of (Z)-icos-11-enoic acid
Density:0.883 g/mL
Molar volume:351.7 mL/mol
Melting point:24 °C

Isomers

ethenyl octadecanoate
Molecular structure of ethenyl octadecanoate
ethyl (E)-octadec-9-enoate
Molecular structure of ethyl (E)-octadec-9-enoate
ethyl (Z)-octadec-9-enoate
Molecular structure of ethyl (Z)-octadec-9-enoate
hexadecyl 2-methylprop-2-enoate
Molecular structure of hexadecyl 2-methylprop-2-enoate
(Z)-icos-11-enoic acid
Molecular structure of (Z)-icos-11-enoic acid
(13Z)-icos-13-enoic acid
Molecular structure of (13Z)-icos-13-enoic acid
(Z)-icos-9-enoic acid
Molecular structure of (Z)-icos-9-enoic acid
  ::